C17H22FNO2 — CID 132649976
methyl 2-(6-fluoro-2,2,4-trimethylquinolin-1-yl)butanoate (PubChem CID 132649976) has the molecular formula C17H22FNO2 and a molecular weight of 291.37 g/mol. Its IUPAC name is methyl 2-(6-fluoro-2,2,4-trimethylquinolin-1-yl)butanoate.
| Compound Name | methyl 2-(6-fluoro-2,2,4-trimethylquinolin-1-yl)butanoate |
|---|---|
| PubChem CID | 132649976 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | methyl 2-(6-fluoro-2,2,4-trimethylquinolin-1-yl)butanoate |
| SMILES | CCC(C(=O)OC)N1c2ccc(F)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C17H22FNO2/c1-6-14(16(20)21-5)19-15-8-7-12(18)9-13(15)11(2)10-17(19,3)4/h7-10,14H,6H2,1-5H3 |
| InChIKey | ARPBIPLYAJSQBN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |