C17H22FNO2 — CID 125044776
(2S)-2-(6-fluoro-2,2,4-trimethylquinolin-1-yl)-3-methylbutanoic acid (PubChem CID 125044776) has the molecular formula C17H22FNO2 and a molecular weight of 291.37 g/mol. Its IUPAC name is (2S)-2-(6-fluoro-2,2,4-trimethylquinolin-1-yl)-3-methylbutanoic acid.
| Compound Name | (2S)-2-(6-fluoro-2,2,4-trimethylquinolin-1-yl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 125044776 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (2S)-2-(6-fluoro-2,2,4-trimethylquinolin-1-yl)-3-methylbutanoic acid |
| SMILES | CC1=CC(C)(C)N([C@H](C(=O)O)C(C)C)c2ccc(F)cc21 |
| InChI | InChI=1S/C17H22FNO2/c1-10(2)15(16(20)21)19-14-7-6-12(18)8-13(14)11(3)9-17(19,4)5/h6-10,15H,1-5H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | XBXBTQCGQJWJAT-HNNXBMFYSA-N |
| XLogP | 3.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |