C19H29NO2 — CID 125044601
(2S)-3-methyl-2-[(4S)-2,2,4,6,7-pentamethyl-3,4-dihydroquinolin-1-yl]butanoic acid (PubChem CID 125044601) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (2S)-3-methyl-2-[(4S)-2,2,4,6,7-pentamethyl-3,4-dihydroquinolin-1-yl]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[(4S)-2,2,4,6,7-pentamethyl-3,4-dihydroquinolin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 125044601 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (2S)-3-methyl-2-[(4S)-2,2,4,6,7-pentamethyl-3,4-dihydroquinolin-1-yl]butanoic acid |
| SMILES | Cc1cc2c(cc1C)N([C@H](C(=O)O)C(C)C)C(C)(C)C[C@@H]2C |
| InChI | InChI=1S/C19H29NO2/c1-11(2)17(18(21)22)20-16-9-13(4)12(3)8-15(16)14(5)10-19(20,6)7/h8-9,11,14,17H,10H2,1-7H3,(H,21,22)/t14-,17-/m0/s1 |
| InChIKey | NJMUHVOSRYZCCW-YOEHRIQHSA-N |
| XLogP | 4.50 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |