C24H25NO4S — CID 59942886
5-[2-(2,2,4,6,7-pentamethyl-3,4-dihydroquinolin-1-yl)ethynylsulfanyl]benzene-1,3-dicarboxylic acid (PubChem CID 59942886) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is 5-[2-(2,2,4,6,7-pentamethyl-3,4-dihydroquinolin-1-yl)ethynylsulfanyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[2-(2,2,4,6,7-pentamethyl-3,4-dihydroquinolin-1-yl)ethynylsulfanyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 59942886 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 5-[2-(2,2,4,6,7-pentamethyl-3,4-dihydroquinolin-1-yl)ethynylsulfanyl]benzene-1,3-dicarboxylic acid |
| SMILES | Cc1cc2c(cc1C)N(C#CSc1cc(C(=O)O)cc(C(=O)O)c1)C(C)(C)CC2C |
| InChI | InChI=1S/C24H25NO4S/c1-14-8-20-16(3)13-24(4,5)25(21(20)9-15(14)2)6-7-30-19-11-17(22(26)27)10-18(12-19)23(28)29/h8-12,16H,13H2,1-5H3,(H,26,27)(H,28,29) |
| InChIKey | YSYBNBNBZPKELD-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|