C17H22ClNO — CID 3695084
2-chloro-1-(2,2,4,6,7-pentamethylquinolin-1-yl)propan-1-one (PubChem CID 3695084) has the molecular formula C17H22ClNO and a molecular weight of 291.82 g/mol. Its IUPAC name is 2-chloro-1-(2,2,4,6,7-pentamethylquinolin-1-yl)propan-1-one.
| Compound Name | 2-chloro-1-(2,2,4,6,7-pentamethylquinolin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 3695084 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-chloro-1-(2,2,4,6,7-pentamethylquinolin-1-yl)propan-1-one |
| SMILES | CC1=CC(C)(C)N(C(=O)C(C)Cl)c2cc(C)c(C)cc21 |
| InChI | InChI=1S/C17H22ClNO/c1-10-7-14-12(3)9-17(5,6)19(16(20)13(4)18)15(14)8-11(10)2/h7-9,13H,1-6H3 |
| InChIKey | UVJYGVJNMWEGTF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|