C18H22N4OS2 — CID 1319970
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-(2,2,4,6,7-pentamethylquinolin-1-yl)ethanone (PubChem CID 1319970) has the molecular formula C18H22N4OS2 and a molecular weight of 374.54 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-(2,2,4,6,7-pentamethylquinolin-1-yl)ethanone.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-(2,2,4,6,7-pentamethylquinolin-1-yl)ethanone |
|---|---|
| PubChem CID | 1319970 |
| Molecular Formula | C18H22N4OS2 |
| Molecular Weight | 374.54 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-1-(2,2,4,6,7-pentamethylquinolin-1-yl)ethanone |
| SMILES | CC1=CC(C)(C)N(C(=O)CSc2nnc(N)s2)c2cc(C)c(C)cc21 |
| InChI | InChI=1S/C18H22N4OS2/c1-10-6-13-12(3)8-18(4,5)22(14(13)7-11(10)2)15(23)9-24-17-21-20-16(19)25-17/h6-8H,9H2,1-5H3,(H2,19,20) |
| InChIKey | GFRBEVJGVMCGCJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |