C28H35N3O5 — CID 17254561
oxalic acid;1-(2,2,4,6,7-pentamethylquinolin-1-yl)-2-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 17254561) has the molecular formula C28H35N3O5 and a molecular weight of 493.60 g/mol. Its IUPAC name is oxalic acid;1-(2,2,4,6,7-pentamethylquinolin-1-yl)-2-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | oxalic acid;1-(2,2,4,6,7-pentamethylquinolin-1-yl)-2-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 17254561 |
| Molecular Formula | C28H35N3O5 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | oxalic acid;1-(2,2,4,6,7-pentamethylquinolin-1-yl)-2-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | CC1=CC(C)(C)N(C(=O)CN2CCN(c3ccccc3)CC2)c2cc(C)c(C)cc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H33N3O.C2H2O4/c1-19-15-23-21(3)17-26(4,5)29(24(23)16-20(19)2)25(30)18-27-11-13-28(14-12-27)22-9-7-6-8-10-22;3-1(4)2(5)6/h6-10,15-17H,11-14,18H2,1-5H3;(H,3,4)(H,5,6) |
| InChIKey | YXZQTHYDYSUCAO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|