C25H31N3O — CID 91670562
2-(4-phenylpiperazin-1-yl)-1-(2,2,4,6-tetramethylquinolin-1-yl)ethanone (PubChem CID 91670562) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is 2-(4-phenylpiperazin-1-yl)-1-(2,2,4,6-tetramethylquinolin-1-yl)ethanone.
| Compound Name | 2-(4-phenylpiperazin-1-yl)-1-(2,2,4,6-tetramethylquinolin-1-yl)ethanone |
|---|---|
| PubChem CID | 91670562 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 2-(4-phenylpiperazin-1-yl)-1-(2,2,4,6-tetramethylquinolin-1-yl)ethanone |
| SMILES | CC1=CC(C)(C)N(C(=O)CN2CCN(c3ccccc3)CC2)c2ccc(C)cc21 |
| InChI | InChI=1S/C25H31N3O/c1-19-10-11-23-22(16-19)20(2)17-25(3,4)28(23)24(29)18-26-12-14-27(15-13-26)21-8-6-5-7-9-21/h5-11,16-17H,12-15,18H2,1-4H3 |
| InChIKey | RPSGSYXMCXOZOE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |