About 2-morpholin-4-yl-1-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone
2-morpholin-4-yl-1-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone (PubChem CID 3119223) has the molecular formula C37H38N2O2
and a molecular weight of 542.72 g/mol. Its IUPAC name is 2-morpholin-4-yl-1-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone.
Molecular Properties
| Compound Name | 2-morpholin-4-yl-1-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone |
| PubChem CID | 3119223 |
| Molecular Formula | C37H38N2O2 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | 2-morpholin-4-yl-1-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone |
| SMILES | CC1=CC(C)(C)N(C(=O)CN2CCOCC2)c2ccc(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C37H38N2O2/c1-28-26-36(2,3)39(35(40)27-38-21-23-41-24-22-38)34-20-19-32(25-33(28)34)37(29-13-7-4-8-14-29,30-15-9-5-10-16-30)31-17-11-6-12-18-31/h4-20,25-26H,21-24,27H2,1-3H3 |
| InChIKey | BBVIGYMXMJEKHV-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-morpholin-4-yl-1-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-yl-1-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone?
The IUPAC name of 2-morpholin-4-yl-1-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone (CID 3119223) is 2-morpholin-4-yl-1-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone.
What is the SMILES notation for 2-morpholin-4-yl-1-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone?
The canonical SMILES for 2-morpholin-4-yl-1-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone is CC1=CC(C)(C)N(C(=O)CN2CCOCC2)c2ccc(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc21.
What is the InChIKey of 2-morpholin-4-yl-1-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone?
The InChIKey is BBVIGYMXMJEKHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H38N2O2/c1-28-26-36(2,3)39(35(40)27-38-21-23-41-24-22-38)34-20-19-32(25-33(28)34)37(29-13-7-4-8-14-29,30-15-9-5-10-16-30)31-17-11-6-12-18-31/h4-20,25-26H,21-24,27H2,1-3H3.
What are the key properties of 2-morpholin-4-yl-1-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone?
2-morpholin-4-yl-1-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone has a molecular weight of 542.72 g/mol, XLogP of 6.93, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-yl-1-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethanone is sourced from PubChem (CID 3119223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).