C45H36N2O3 — CID 3116603
2-[2-oxo-2-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 3116603) has the molecular formula C45H36N2O3 and a molecular weight of 652.79 g/mol. Its IUPAC name is 2-[2-oxo-2-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2-oxo-2-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 3116603 |
| Molecular Formula | C45H36N2O3 |
| Molecular Weight | 652.79 g/mol |
| Exact Mass | 652.27 |
| IUPAC Name | 2-[2-oxo-2-(2,2,4-trimethyl-6-tritylquinolin-1-yl)ethyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | CC1=CC(C)(C)N(C(=O)CN2C(=O)c3cccc4cccc(c34)C2=O)c2ccc(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C45H36N2O3/c1-30-28-44(2,3)47(40(48)29-46-42(49)36-23-13-15-31-16-14-24-37(41(31)36)43(46)50)39-26-25-35(27-38(30)39)45(32-17-7-4-8-18-32,33-19-9-5-10-20-33)34-21-11-6-12-22-34/h4-28H,29H2,1-3H3 |
| InChIKey | WMACFFWLMUTNQE-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.79 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|