C22H18N2O3 — CID 113202033
N-(2,3-dimethylphenyl)-2-(1,3-dioxobenzo[de]isoquinolin-2-yl)acetamide (PubChem CID 113202033) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-(1,3-dioxobenzo[de]isoquinolin-2-yl)acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-(1,3-dioxobenzo[de]isoquinolin-2-yl)acetamide |
|---|---|
| PubChem CID | 113202033 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-(1,3-dioxobenzo[de]isoquinolin-2-yl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)c3cccc4cccc(c34)C2=O)c1C |
| InChI | InChI=1S/C22H18N2O3/c1-13-6-3-11-18(14(13)2)23-19(25)12-24-21(26)16-9-4-7-15-8-5-10-17(20(15)16)22(24)27/h3-11H,12H2,1-2H3,(H,23,25) |
| InChIKey | UFOMSHAXZBYRIY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|