C21H16N2O4 — CID 1084274
methyl 2-[[2-(2-oxobenzo[cd]indol-1-yl)acetyl]amino]benzoate (PubChem CID 1084274) has the molecular formula C21H16N2O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is methyl 2-[[2-(2-oxobenzo[cd]indol-1-yl)acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(2-oxobenzo[cd]indol-1-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 1084274 |
| Molecular Formula | C21H16N2O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | methyl 2-[[2-(2-oxobenzo[cd]indol-1-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CN1C(=O)c2cccc3cccc1c23 |
| InChI | InChI=1S/C21H16N2O4/c1-27-21(26)14-8-2-3-10-16(14)22-18(24)12-23-17-11-5-7-13-6-4-9-15(19(13)17)20(23)25/h2-11H,12H2,1H3,(H,22,24) |
| InChIKey | PJHVGVIQKWHZPR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |