C22H18N2O4 — CID 1083001
ethyl 4-[[2-(2-oxobenzo[cd]indol-1-yl)acetyl]amino]benzoate (PubChem CID 1083001) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is ethyl 4-[[2-(2-oxobenzo[cd]indol-1-yl)acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(2-oxobenzo[cd]indol-1-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 1083001 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | ethyl 4-[[2-(2-oxobenzo[cd]indol-1-yl)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN2C(=O)c3cccc4cccc2c34)cc1 |
| InChI | InChI=1S/C22H18N2O4/c1-2-28-22(27)15-9-11-16(12-10-15)23-19(25)13-24-18-8-4-6-14-5-3-7-17(20(14)18)21(24)26/h3-12H,2,13H2,1H3,(H,23,25) |
| InChIKey | RHFFTCMOANSPCK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |