C23H19N3O5S2 — CID 3698270
ethyl 4-[[2-[3-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-2-oxoindol-1-yl]acetyl]amino]benzoate (PubChem CID 3698270) has the molecular formula C23H19N3O5S2 and a molecular weight of 481.56 g/mol. Its IUPAC name is ethyl 4-[[2-[3-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-2-oxoindol-1-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[3-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-2-oxoindol-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 3698270 |
| Molecular Formula | C23H19N3O5S2 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | ethyl 4-[[2-[3-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-2-oxoindol-1-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(C)C3=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C23H19N3O5S2/c1-3-31-22(30)13-8-10-14(11-9-13)24-17(27)12-26-16-7-5-4-6-15(16)18(20(26)28)19-21(29)25(2)23(32)33-19/h4-11H,3,12H2,1-2H3,(H,24,27) |
| InChIKey | UAOIFPPTDPNVNB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|