C24H23N3O3S2 — CID 3803003
N-(3,4-dimethylphenyl)-2-[2-oxo-3-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)indol-1-yl]acetamide (PubChem CID 3803003) has the molecular formula C24H23N3O3S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[2-oxo-3-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)indol-1-yl]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[2-oxo-3-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)indol-1-yl]acetamide |
|---|---|
| PubChem CID | 3803003 |
| Molecular Formula | C24H23N3O3S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[2-oxo-3-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)indol-1-yl]acetamide |
| SMILES | CCCN1C(=O)C(=C2C(=O)N(CC(=O)Nc3ccc(C)c(C)c3)c3ccccc32)SC1=S |
| InChI | InChI=1S/C24H23N3O3S2/c1-4-11-26-23(30)21(32-24(26)31)20-17-7-5-6-8-18(17)27(22(20)29)13-19(28)25-16-10-9-14(2)15(3)12-16/h5-10,12H,4,11,13H2,1-3H3,(H,25,28) |
| InChIKey | FMPMESLLBFQOQW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|