About (3-nitrophenyl)-(2,2,4-trimethyl-6-tritylquinolin-1-yl)methanone
(3-nitrophenyl)-(2,2,4-trimethyl-6-tritylquinolin-1-yl)methanone (PubChem CID 2857133) has the molecular formula C38H32N2O3
and a molecular weight of 564.69 g/mol. Its IUPAC name is (3-nitrophenyl)-(2,2,4-trimethyl-6-tritylquinolin-1-yl)methanone.
Molecular Properties
| Compound Name | (3-nitrophenyl)-(2,2,4-trimethyl-6-tritylquinolin-1-yl)methanone |
| PubChem CID | 2857133 |
| Molecular Formula | C38H32N2O3 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | (3-nitrophenyl)-(2,2,4-trimethyl-6-tritylquinolin-1-yl)methanone |
| SMILES | CC1=CC(C)(C)N(C(=O)c2cccc([N+](=O)[O-])c2)c2ccc(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C38H32N2O3/c1-27-26-37(2,3)39(36(41)28-14-13-21-33(24-28)40(42)43)35-23-22-32(25-34(27)35)38(29-15-7-4-8-16-29,30-17-9-5-10-18-30)31-19-11-6-12-20-31/h4-26H,1-3H3 |
| InChIKey | WWAHVDDTNSKJBE-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (3-nitrophenyl)-(2,2,4-trimethyl-6-tritylquinolin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-nitrophenyl)-(2,2,4-trimethyl-6-tritylquinolin-1-yl)methanone?
The IUPAC name of (3-nitrophenyl)-(2,2,4-trimethyl-6-tritylquinolin-1-yl)methanone (CID 2857133) is (3-nitrophenyl)-(2,2,4-trimethyl-6-tritylquinolin-1-yl)methanone.
What is the SMILES notation for (3-nitrophenyl)-(2,2,4-trimethyl-6-tritylquinolin-1-yl)methanone?
The canonical SMILES for (3-nitrophenyl)-(2,2,4-trimethyl-6-tritylquinolin-1-yl)methanone is CC1=CC(C)(C)N(C(=O)c2cccc([N+](=O)[O-])c2)c2ccc(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc21.
What is the InChIKey of (3-nitrophenyl)-(2,2,4-trimethyl-6-tritylquinolin-1-yl)methanone?
The InChIKey is WWAHVDDTNSKJBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H32N2O3/c1-27-26-37(2,3)39(36(41)28-14-13-21-33(24-28)40(42)43)35-23-22-32(25-34(27)35)38(29-15-7-4-8-16-29,30-17-9-5-10-18-30)31-19-11-6-12-20-31/h4-26H,1-3H3.
What are the key properties of (3-nitrophenyl)-(2,2,4-trimethyl-6-tritylquinolin-1-yl)methanone?
(3-nitrophenyl)-(2,2,4-trimethyl-6-tritylquinolin-1-yl)methanone has a molecular weight of 564.69 g/mol, XLogP of 8.82, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-nitrophenyl)-(2,2,4-trimethyl-6-tritylquinolin-1-yl)methanone is sourced from PubChem (CID 2857133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).