C29H31N3O2 — CID 50864651
2-hydroxy-N-[(Z)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]-2,2-diphenylacetamide (PubChem CID 50864651) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 2-hydroxy-N-[(Z)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]-2,2-diphenylacetamide.
| Compound Name | 2-hydroxy-N-[(Z)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 50864651 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 2-hydroxy-N-[(Z)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]-2,2-diphenylacetamide |
| SMILES | CC1=CC(C)(C)N(C)c2cc(C)c(/C=N\NC(=O)C(O)(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C29H31N3O2/c1-20-16-26-25(21(2)18-28(3,4)32(26)5)17-22(20)19-30-31-27(33)29(34,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-19,34H,1-5H3,(H,31,33)/b30-19- |
| InChIKey | PZBXIEOUFRXQOH-FSGOGVSDSA-N |
| XLogP | 5.01 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|