C23H27N3O — CID 50864674
4-methyl-N-[(Z)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]benzamide (PubChem CID 50864674) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-methyl-N-[(Z)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 4-methyl-N-[(Z)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 50864674 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 4-methyl-N-[(Z)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]benzamide |
| SMILES | CC1=CC(C)(C)N(C)c2cc(C)c(/C=N\NC(=O)c3ccc(C)cc3)cc21 |
| InChI | InChI=1S/C23H27N3O/c1-15-7-9-18(10-8-15)22(27)25-24-14-19-12-20-17(3)13-23(4,5)26(6)21(20)11-16(19)2/h7-14H,1-6H3,(H,25,27)/b24-14- |
| InChIKey | ODAUSELLZGZBOT-OYKKKHCWSA-N |
| XLogP | 4.70 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|