C24H24ClN3O2 — CID 50864660
5-chloro-N-[(Z)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 50864660) has the molecular formula C24H24ClN3O2 and a molecular weight of 421.93 g/mol. Its IUPAC name is 5-chloro-N-[(Z)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-[(Z)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 50864660 |
| Molecular Formula | C24H24ClN3O2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 5-chloro-N-[(Z)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | CC1=CC(C)(C)N(C)c2cc(C)c(/C=N\NC(=O)c3cc4cc(Cl)ccc4o3)cc21 |
| InChI | InChI=1S/C24H24ClN3O2/c1-14-8-20-19(15(2)12-24(3,4)28(20)5)10-17(14)13-26-27-23(29)22-11-16-9-18(25)6-7-21(16)30-22/h6-13H,1-5H3,(H,27,29)/b26-13- |
| InChIKey | LCGMIIVFKSRZFM-ZMFRSBBQSA-N |
| XLogP | 5.79 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|