C23H22ClN3O2 — CID 133170270
N-[(Z)-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 133170270) has the molecular formula C23H22ClN3O2 and a molecular weight of 407.90 g/mol. Its IUPAC name is N-[(Z)-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | N-[(Z)-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 133170270 |
| Molecular Formula | C23H22ClN3O2 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N-[(Z)-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | CC1=CC(C)(C)N(C)c2cc(Cl)c(/C=N\NC(=O)c3cc4ccccc4o3)cc21 |
| InChI | InChI=1S/C23H22ClN3O2/c1-14-12-23(2,3)27(4)19-11-18(24)16(9-17(14)19)13-25-26-22(28)21-10-15-7-5-6-8-20(15)29-21/h5-13H,1-4H3,(H,26,28)/b25-13- |
| InChIKey | VRVALXMPVBMUIY-MXAYSNPKSA-N |
| XLogP | 5.48 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|