C25H24ClN3O — CID 50864943
N-[(Z)-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]naphthalene-1-carboxamide (PubChem CID 50864943) has the molecular formula C25H24ClN3O and a molecular weight of 417.94 g/mol. Its IUPAC name is N-[(Z)-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]naphthalene-1-carboxamide.
| Compound Name | N-[(Z)-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 50864943 |
| Molecular Formula | C25H24ClN3O |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | N-[(Z)-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)methylideneamino]naphthalene-1-carboxamide |
| SMILES | CC1=CC(C)(C)N(C)c2cc(Cl)c(/C=N\NC(=O)c3cccc4ccccc34)cc21 |
| InChI | InChI=1S/C25H24ClN3O/c1-16-14-25(2,3)29(4)23-13-22(26)18(12-21(16)23)15-27-28-24(30)20-11-7-9-17-8-5-6-10-19(17)20/h5-15H,1-4H3,(H,28,30)/b27-15- |
| InChIKey | NZEKGKLYVPNAAM-DICXZTSXSA-N |
| XLogP | 5.89 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|