C25H24Br2ClN3O2 — CID 50868838
5,7-dibromo-N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 50868838) has the molecular formula C25H24Br2ClN3O2 and a molecular weight of 593.75 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 50868838 |
| Molecular Formula | C25H24Br2ClN3O2 |
| Molecular Weight | 593.75 g/mol |
| Exact Mass | 590.99 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-(7-chloro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | CCCN1c2cc(Cl)c(/C=N\NC(=O)c3cc4cc(Br)cc(Br)c4o3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C25H24Br2ClN3O2/c1-5-6-31-21-11-20(28)16(8-18(21)14(2)12-25(31,3)4)13-29-30-24(32)22-9-15-7-17(26)10-19(27)23(15)33-22/h7-13H,5-6H2,1-4H3,(H,30,32)/b29-13- |
| InChIKey | AXJMMCSEGYQJEE-DBFSUHOCSA-N |
| XLogP | 7.79 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.75 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|