C26H27Br2N3O2 — CID 50868732
5,7-dibromo-N-[(Z)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 50868732) has the molecular formula C26H27Br2N3O2 and a molecular weight of 573.33 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 50868732 |
| Molecular Formula | C26H27Br2N3O2 |
| Molecular Weight | 573.33 g/mol |
| Exact Mass | 571.05 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | CCCN1c2cc(C)c(/C=N\NC(=O)c3cc4cc(Br)cc(Br)c4o3)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C26H27Br2N3O2/c1-6-7-31-22-8-15(2)18(10-20(22)16(3)13-26(31,4)5)14-29-30-25(32)23-11-17-9-19(27)12-21(28)24(17)33-23/h8-14H,6-7H2,1-5H3,(H,30,32)/b29-14- |
| InChIKey | PXLLBHYWFGCBGC-NUJZUDFISA-N |
| XLogP | 7.44 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.33 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|