C25H30BrN3O2 — CID 50868736
5-bromo-2-methoxy-N-[(Z)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]benzamide (PubChem CID 50868736) has the molecular formula C25H30BrN3O2 and a molecular weight of 484.44 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-[(Z)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 5-bromo-2-methoxy-N-[(Z)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 50868736 |
| Molecular Formula | C25H30BrN3O2 |
| Molecular Weight | 484.44 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 5-bromo-2-methoxy-N-[(Z)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]benzamide |
| SMILES | CCCN1c2cc(C)c(/C=N\NC(=O)c3cc(Br)ccc3OC)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C25H30BrN3O2/c1-7-10-29-22-11-16(2)18(12-20(22)17(3)14-25(29,4)5)15-27-28-24(30)21-13-19(26)8-9-23(21)31-6/h8-9,11-15H,7,10H2,1-6H3,(H,28,30)/b27-15- |
| InChIKey | YXCNRRAGQPXZGF-DICXZTSXSA-N |
| XLogP | 5.94 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.44 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|