About 1-[2,2-dimethyl-4-[(4-phenylpiperazin-1-yl)methyl]quinolin-1-yl]ethanone;hydrochloride
1-[2,2-dimethyl-4-[(4-phenylpiperazin-1-yl)methyl]quinolin-1-yl]ethanone;hydrochloride (PubChem CID 132908906) has the molecular formula C24H30ClN3O
and a molecular weight of 411.98 g/mol. Its IUPAC name is 1-[2,2-dimethyl-4-[(4-phenylpiperazin-1-yl)methyl]quinolin-1-yl]ethanone;hydrochloride.
Molecular Properties
| Compound Name | 1-[2,2-dimethyl-4-[(4-phenylpiperazin-1-yl)methyl]quinolin-1-yl]ethanone;hydrochloride |
| PubChem CID | 132908906 |
| Molecular Formula | C24H30ClN3O |
| Molecular Weight | 411.98 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 1-[2,2-dimethyl-4-[(4-phenylpiperazin-1-yl)methyl]quinolin-1-yl]ethanone;hydrochloride |
| SMILES | CC(=O)N1c2ccccc2C(CN2CCN(c3ccccc3)CC2)=CC1(C)C.Cl |
| InChI | InChI=1S/C24H29N3O.ClH/c1-19(28)27-23-12-8-7-11-22(23)20(17-24(27,2)3)18-25-13-15-26(16-14-25)21-9-5-4-6-10-21;/h4-12,17H,13-16,18H2,1-3H3;1H |
| InChIKey | LWGXIRNHFRZHJK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.98 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2,2-dimethyl-4-[(4-phenylpiperazin-1-yl)methyl]quinolin-1-yl]ethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,2-dimethyl-4-[(4-phenylpiperazin-1-yl)methyl]quinolin-1-yl]ethanone;hydrochloride?
The IUPAC name of 1-[2,2-dimethyl-4-[(4-phenylpiperazin-1-yl)methyl]quinolin-1-yl]ethanone;hydrochloride (CID 132908906) is 1-[2,2-dimethyl-4-[(4-phenylpiperazin-1-yl)methyl]quinolin-1-yl]ethanone;hydrochloride.
What is the SMILES notation for 1-[2,2-dimethyl-4-[(4-phenylpiperazin-1-yl)methyl]quinolin-1-yl]ethanone;hydrochloride?
The canonical SMILES for 1-[2,2-dimethyl-4-[(4-phenylpiperazin-1-yl)methyl]quinolin-1-yl]ethanone;hydrochloride is CC(=O)N1c2ccccc2C(CN2CCN(c3ccccc3)CC2)=CC1(C)C.Cl.
What is the InChIKey of 1-[2,2-dimethyl-4-[(4-phenylpiperazin-1-yl)methyl]quinolin-1-yl]ethanone;hydrochloride?
The InChIKey is LWGXIRNHFRZHJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29N3O.ClH/c1-19(28)27-23-12-8-7-11-22(23)20(17-24(27,2)3)18-25-13-15-26(16-14-25)21-9-5-4-6-10-21;/h4-12,17H,13-16,18H2,1-3H3;1H.
What are the key properties of 1-[2,2-dimethyl-4-[(4-phenylpiperazin-1-yl)methyl]quinolin-1-yl]ethanone;hydrochloride?
1-[2,2-dimethyl-4-[(4-phenylpiperazin-1-yl)methyl]quinolin-1-yl]ethanone;hydrochloride has a molecular weight of 411.98 g/mol, XLogP of 4.46, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,2-dimethyl-4-[(4-phenylpiperazin-1-yl)methyl]quinolin-1-yl]ethanone;hydrochloride is sourced from PubChem (CID 132908906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).