C27H25FN4O2S2 — CID 134717268
(5Z)-5-[6-fluoro-11,11-dimethyl-2-oxo-9-[(4-phenylpiperazin-1-yl)methyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 134717268) has the molecular formula C27H25FN4O2S2 and a molecular weight of 520.66 g/mol. Its IUPAC name is (5Z)-5-[6-fluoro-11,11-dimethyl-2-oxo-9-[(4-phenylpiperazin-1-yl)methyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[6-fluoro-11,11-dimethyl-2-oxo-9-[(4-phenylpiperazin-1-yl)methyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 134717268 |
| Molecular Formula | C27H25FN4O2S2 |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | (5Z)-5-[6-fluoro-11,11-dimethyl-2-oxo-9-[(4-phenylpiperazin-1-yl)methyl]-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-3-ylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC1(C)C=C(CN2CCN(c3ccccc3)CC2)c2cc(F)cc3c2N1C(=O)/C3=C1\SC(=S)NC1=O |
| InChI | InChI=1S/C27H25FN4O2S2/c1-27(2)14-16(15-30-8-10-31(11-9-30)18-6-4-3-5-7-18)19-12-17(28)13-20-21(25(34)32(27)22(19)20)23-24(33)29-26(35)36-23/h3-7,12-14H,8-11,15H2,1-2H3,(H,29,33,35)/b23-21- |
| InChIKey | UHHRZZNLPKOXGR-LNVKXUELSA-N |
| XLogP | 4.03 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|