C23H23N5O4 — CID 172611076
2-(2,4-dioxo-1,3-diazinan-1-yl)-5-[(4-phenylpiperazin-1-yl)methyl]isoindole-1,3-dione (PubChem CID 172611076) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazinan-1-yl)-5-[(4-phenylpiperazin-1-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxo-1,3-diazinan-1-yl)-5-[(4-phenylpiperazin-1-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 172611076 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazinan-1-yl)-5-[(4-phenylpiperazin-1-yl)methyl]isoindole-1,3-dione |
| SMILES | O=C1CCN(N2C(=O)c3ccc(CN4CCN(c5ccccc5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H23N5O4/c29-20-8-9-27(23(32)24-20)28-21(30)18-7-6-16(14-19(18)22(28)31)15-25-10-12-26(13-11-25)17-4-2-1-3-5-17/h1-7,14H,8-13,15H2,(H,24,29,32) |
| InChIKey | XTTCTDDFOAHOHF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|