C13H11N3O5 — CID 172610462
2-(2,4-dioxo-1,3-diazinan-1-yl)-5-(hydroxymethyl)isoindole-1,3-dione (PubChem CID 172610462) has the molecular formula C13H11N3O5 and a molecular weight of 289.25 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazinan-1-yl)-5-(hydroxymethyl)isoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxo-1,3-diazinan-1-yl)-5-(hydroxymethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 172610462 |
| Molecular Formula | C13H11N3O5 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazinan-1-yl)-5-(hydroxymethyl)isoindole-1,3-dione |
| SMILES | O=C1CCN(N2C(=O)c3ccc(CO)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C13H11N3O5/c17-6-7-1-2-8-9(5-7)12(20)16(11(8)19)15-4-3-10(18)14-13(15)21/h1-2,5,17H,3-4,6H2,(H,14,18,21) |
| InChIKey | MFWUPEUUYFAKMF-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|