C25H23F3N4O4 — CID 172611125
2-(2,4-dioxo-1,3-diazinan-1-yl)-5-[[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methyl]isoindole-1,3-dione (PubChem CID 172611125) has the molecular formula C25H23F3N4O4 and a molecular weight of 500.48 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazinan-1-yl)-5-[[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxo-1,3-diazinan-1-yl)-5-[[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 172611125 |
| Molecular Formula | C25H23F3N4O4 |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazinan-1-yl)-5-[[4-[2-(trifluoromethyl)phenyl]piperidin-1-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1CCN(N2C(=O)c3ccc(CN4CCC(c5ccccc5C(F)(F)F)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H23F3N4O4/c26-25(27,28)20-4-2-1-3-17(20)16-7-10-30(11-8-16)14-15-5-6-18-19(13-15)23(35)32(22(18)34)31-12-9-21(33)29-24(31)36/h1-6,13,16H,7-12,14H2,(H,29,33,36) |
| InChIKey | MABSEMYGIVUDGH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|