C29H30N6O4S — CID 172611180
2-(2,4-dioxo-1,3-diazinan-1-yl)-5-[[4-(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperidin-1-yl]methyl]isoindole-1,3-dione (PubChem CID 172611180) has the molecular formula C29H30N6O4S and a molecular weight of 558.66 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazinan-1-yl)-5-[[4-(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperidin-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxo-1,3-diazinan-1-yl)-5-[[4-(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperidin-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 172611180 |
| Molecular Formula | C29H30N6O4S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazinan-1-yl)-5-[[4-(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)piperidin-1-yl]methyl]isoindole-1,3-dione |
| SMILES | Cc1nc(C2CCN(Cc3ccc4c(c3)C(=O)N(N3CCC(=O)NC3=O)C4=O)CC2)c2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C29H30N6O4S/c1-16-30-25(24-20-4-2-3-5-22(20)40-26(24)31-16)18-8-11-33(12-9-18)15-17-6-7-19-21(14-17)28(38)35(27(19)37)34-13-10-23(36)32-29(34)39/h6-7,14,18H,2-5,8-13,15H2,1H3,(H,32,36,39) |
| InChIKey | QFMCDUAVOFKBRX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|