C24H21FN6O5 — CID 172611126
2-(2,4-dioxo-1,3-diazinan-1-yl)-5-[[4-(6-fluoro-1,2-benzoxazol-3-yl)piperazin-1-yl]methyl]isoindole-1,3-dione (PubChem CID 172611126) has the molecular formula C24H21FN6O5 and a molecular weight of 492.47 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazinan-1-yl)-5-[[4-(6-fluoro-1,2-benzoxazol-3-yl)piperazin-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxo-1,3-diazinan-1-yl)-5-[[4-(6-fluoro-1,2-benzoxazol-3-yl)piperazin-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 172611126 |
| Molecular Formula | C24H21FN6O5 |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazinan-1-yl)-5-[[4-(6-fluoro-1,2-benzoxazol-3-yl)piperazin-1-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1CCN(N2C(=O)c3ccc(CN4CCN(c5noc6cc(F)ccc56)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H21FN6O5/c25-15-2-4-17-19(12-15)36-27-21(17)29-9-7-28(8-10-29)13-14-1-3-16-18(11-14)23(34)31(22(16)33)30-6-5-20(32)26-24(30)35/h1-4,11-12H,5-10,13H2,(H,26,32,35) |
| InChIKey | VWBJVUXJRIUYLU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|