C34H29ClN8O4 — CID 172610714
5-[[4-[3-chloro-5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]piperazin-1-yl]methyl]-2-(2,4-dioxo-1,3-diazinan-1-yl)isoindole-1,3-dione (PubChem CID 172610714) has the molecular formula C34H29ClN8O4 and a molecular weight of 649.11 g/mol. Its IUPAC name is 5-[[4-[3-chloro-5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]piperazin-1-yl]methyl]-2-(2,4-dioxo-1,3-diazinan-1-yl)isoindole-1,3-dione.
| Compound Name | 5-[[4-[3-chloro-5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]piperazin-1-yl]methyl]-2-(2,4-dioxo-1,3-diazinan-1-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 172610714 |
| Molecular Formula | C34H29ClN8O4 |
| Molecular Weight | 649.11 g/mol |
| Exact Mass | 648.20 |
| IUPAC Name | 5-[[4-[3-chloro-5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]piperazin-1-yl]methyl]-2-(2,4-dioxo-1,3-diazinan-1-yl)isoindole-1,3-dione |
| SMILES | Cn1c2ccncc2c2ccc(-c3cnc(N4CCN(Cc5ccc6c(c5)C(=O)N(N5CCC(=O)NC5=O)C6=O)CC4)c(Cl)c3)cc21 |
| InChI | InChI=1S/C34H29ClN8O4/c1-39-28-6-8-36-18-26(28)23-5-3-21(16-29(23)39)22-15-27(35)31(37-17-22)41-12-10-40(11-13-41)19-20-2-4-24-25(14-20)33(46)43(32(24)45)42-9-7-30(44)38-34(42)47/h2-6,8,14-18H,7,9-13,19H2,1H3,(H,38,44,47) |
| InChIKey | YIZRENJMZZIGQB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.11 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|