C40H38F3N9O4 — CID 172610395
2-(2,4-dioxo-1,3-diazinan-1-yl)-4-[4-[[4-[5-[5-(2,2,2-trifluoroethyl)pyrido[4,3-b]indol-7-yl]-2-pyridinyl]piperazin-1-yl]methyl]piperidin-1-yl]isoindole-1,3-dione (PubChem CID 172610395) has the molecular formula C40H38F3N9O4 and a molecular weight of 765.80 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazinan-1-yl)-4-[4-[[4-[5-[5-(2,2,2-trifluoroethyl)pyrido[4,3-b]indol-7-yl]-2-pyridinyl]piperazin-1-yl]methyl]piperidin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxo-1,3-diazinan-1-yl)-4-[4-[[4-[5-[5-(2,2,2-trifluoroethyl)pyrido[4,3-b]indol-7-yl]-2-pyridinyl]piperazin-1-yl]methyl]piperidin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 172610395 |
| Molecular Formula | C40H38F3N9O4 |
| Molecular Weight | 765.80 g/mol |
| Exact Mass | 765.30 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazinan-1-yl)-4-[4-[[4-[5-[5-(2,2,2-trifluoroethyl)pyrido[4,3-b]indol-7-yl]-2-pyridinyl]piperazin-1-yl]methyl]piperidin-1-yl]isoindole-1,3-dione |
| SMILES | O=C1CCN(N2C(=O)c3cccc(N4CCC(CN5CCN(c6ccc(-c7ccc8c9cnccc9n(CC(F)(F)F)c8c7)cn6)CC5)CC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C40H38F3N9O4/c41-40(42,43)24-50-31-8-12-44-22-30(31)28-6-4-26(20-33(28)50)27-5-7-34(45-21-27)49-18-16-47(17-19-49)23-25-9-13-48(14-10-25)32-3-1-2-29-36(32)38(55)52(37(29)54)51-15-11-35(53)46-39(51)56/h1-8,12,20-22,25H,9-11,13-19,23-24H2,(H,46,53,56) |
| InChIKey | GLKXWOVVIBJNNI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.80 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|