C30H37N5 — CID 170936017
7-[6-[4-[(4-ethylpiperidin-1-yl)methyl]piperidin-1-yl]-3-pyridinyl]-5-methylpyrido[4,3-b]indole (PubChem CID 170936017) has the molecular formula C30H37N5 and a molecular weight of 467.66 g/mol. Its IUPAC name is 7-[6-[4-[(4-ethylpiperidin-1-yl)methyl]piperidin-1-yl]-3-pyridinyl]-5-methylpyrido[4,3-b]indole.
| Compound Name | 7-[6-[4-[(4-ethylpiperidin-1-yl)methyl]piperidin-1-yl]-3-pyridinyl]-5-methylpyrido[4,3-b]indole |
|---|---|
| PubChem CID | 170936017 |
| Molecular Formula | C30H37N5 |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | 7-[6-[4-[(4-ethylpiperidin-1-yl)methyl]piperidin-1-yl]-3-pyridinyl]-5-methylpyrido[4,3-b]indole |
| SMILES | CCC1CCN(CC2CCN(c3ccc(-c4ccc5c6cnccc6n(C)c5c4)cn3)CC2)CC1 |
| InChI | InChI=1S/C30H37N5/c1-3-22-9-14-34(15-10-22)21-23-11-16-35(17-12-23)30-7-5-25(19-32-30)24-4-6-26-27-20-31-13-8-28(27)33(2)29(26)18-24/h4-8,13,18-20,22-23H,3,9-12,14-17,21H2,1-2H3 |
| InChIKey | OZZUBWNNFZNZDV-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|