C29H34N4O — CID 170936025
7-[6-[3-[(4-ethylpiperidin-1-yl)methyl]cyclobutyl]oxy-3-pyridinyl]-5-methylpyrido[4,3-b]indole (PubChem CID 170936025) has the molecular formula C29H34N4O and a molecular weight of 454.62 g/mol. Its IUPAC name is 7-[6-[3-[(4-ethylpiperidin-1-yl)methyl]cyclobutyl]oxy-3-pyridinyl]-5-methylpyrido[4,3-b]indole.
| Compound Name | 7-[6-[3-[(4-ethylpiperidin-1-yl)methyl]cyclobutyl]oxy-3-pyridinyl]-5-methylpyrido[4,3-b]indole |
|---|---|
| PubChem CID | 170936025 |
| Molecular Formula | C29H34N4O |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 7-[6-[3-[(4-ethylpiperidin-1-yl)methyl]cyclobutyl]oxy-3-pyridinyl]-5-methylpyrido[4,3-b]indole |
| SMILES | CCC1CCN(CC2CC(Oc3ccc(-c4ccc5c6cnccc6n(C)c5c4)cn3)C2)CC1 |
| InChI | InChI=1S/C29H34N4O/c1-3-20-9-12-33(13-10-20)19-21-14-24(15-21)34-29-7-5-23(17-31-29)22-4-6-25-26-18-30-11-8-27(26)32(2)28(25)16-22/h4-8,11,16-18,20-21,24H,3,9-10,12-15,19H2,1-2H3 |
| InChIKey | GKMALKVZBVUWOK-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|