C31H37N3O5 — CID 134489351
5-methyl-7-[6-[3-[3-[2-(oxan-2-yloxy)ethoxy]propoxy]cyclobutyl]oxy-3-pyridinyl]pyrido[4,3-b]indole (PubChem CID 134489351) has the molecular formula C31H37N3O5 and a molecular weight of 531.65 g/mol. Its IUPAC name is 5-methyl-7-[6-[3-[3-[2-(oxan-2-yloxy)ethoxy]propoxy]cyclobutyl]oxy-3-pyridinyl]pyrido[4,3-b]indole.
| Compound Name | 5-methyl-7-[6-[3-[3-[2-(oxan-2-yloxy)ethoxy]propoxy]cyclobutyl]oxy-3-pyridinyl]pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 134489351 |
| Molecular Formula | C31H37N3O5 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 5-methyl-7-[6-[3-[3-[2-(oxan-2-yloxy)ethoxy]propoxy]cyclobutyl]oxy-3-pyridinyl]pyrido[4,3-b]indole |
| SMILES | Cn1c2ccncc2c2ccc(-c3ccc(OC4CC(OCCCOCCOC5CCCCO5)C4)nc3)cc21 |
| InChI | InChI=1S/C31H37N3O5/c1-34-28-10-11-32-21-27(28)26-8-6-22(17-29(26)34)23-7-9-30(33-20-23)39-25-18-24(19-25)36-14-4-12-35-15-16-38-31-5-2-3-13-37-31/h6-11,17,20-21,24-25,31H,2-5,12-16,18-19H2,1H3 |
| InChIKey | QDYPSGZGVYHLCH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 76.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|