C35H40N4O5 — CID 134489320
5-methyl-7-[6-[3-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]azetidin-1-yl]-3-pyridinyl]pyrido[4,3-b]indole (PubChem CID 134489320) has the molecular formula C35H40N4O5 and a molecular weight of 596.73 g/mol. Its IUPAC name is 5-methyl-7-[6-[3-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]azetidin-1-yl]-3-pyridinyl]pyrido[4,3-b]indole.
| Compound Name | 5-methyl-7-[6-[3-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]azetidin-1-yl]-3-pyridinyl]pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 134489320 |
| Molecular Formula | C35H40N4O5 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | 5-methyl-7-[6-[3-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]azetidin-1-yl]-3-pyridinyl]pyrido[4,3-b]indole |
| SMILES | Cn1c2ccncc2c2ccc(-c3ccc(N4CC(OCCOCCOCCOCCOCc5ccccc5)C4)nc3)cc21 |
| InChI | InChI=1S/C35H40N4O5/c1-38-33-11-12-36-23-32(33)31-9-7-28(21-34(31)38)29-8-10-35(37-22-29)39-24-30(25-39)44-20-19-42-16-15-40-13-14-41-17-18-43-26-27-5-3-2-4-6-27/h2-12,21-23,30H,13-20,24-26H2,1H3 |
| InChIKey | HZFGELUXWNDBGZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 80.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|