C35H42F2N4O6 — CID 165370931
tert-butyl 3-[2,2-difluoro-3-[3-[3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxypropoxy]propoxy]azetidine-1-carboxylate (PubChem CID 165370931) has the molecular formula C35H42F2N4O6 and a molecular weight of 652.74 g/mol. Its IUPAC name is tert-butyl 3-[2,2-difluoro-3-[3-[3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxypropoxy]propoxy]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2,2-difluoro-3-[3-[3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxypropoxy]propoxy]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 165370931 |
| Molecular Formula | C35H42F2N4O6 |
| Molecular Weight | 652.74 g/mol |
| Exact Mass | 652.31 |
| IUPAC Name | tert-butyl 3-[2,2-difluoro-3-[3-[3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxypropoxy]propoxy]azetidine-1-carboxylate |
| SMILES | Cn1c2ccncc2c2ccc(-c3ccc(OC4CC(OCCCOCC(F)(F)COC5CN(C(=O)OC(C)(C)C)C5)C4)nc3)cc21 |
| InChI | InChI=1S/C35H42F2N4O6/c1-34(2,3)47-33(42)41-19-27(20-41)45-22-35(36,37)21-43-12-5-13-44-25-15-26(16-25)46-32-9-7-24(17-39-32)23-6-8-28-29-18-38-11-10-30(29)40(4)31(28)14-23/h6-11,14,17-18,25-27H,5,12-13,15-16,19-22H2,1-4H3 |
| InChIKey | FFUQJCWCADCDIP-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 97.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.74 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|