C36H46N4O6 — CID 134489357
tert-butyl 4-[2-[3-[3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxypropoxy]ethoxy]piperidine-1-carboxylate (PubChem CID 134489357) has the molecular formula C36H46N4O6 and a molecular weight of 630.79 g/mol. Its IUPAC name is tert-butyl 4-[2-[3-[3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxypropoxy]ethoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[3-[3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxypropoxy]ethoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 134489357 |
| Molecular Formula | C36H46N4O6 |
| Molecular Weight | 630.79 g/mol |
| Exact Mass | 630.34 |
| IUPAC Name | tert-butyl 4-[2-[3-[3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]oxypropoxy]ethoxy]piperidine-1-carboxylate |
| SMILES | Cn1c2ccncc2c2ccc(-c3ccc(OC4CC(OCCCOCCOC5CCN(C(=O)OC(C)(C)C)CC5)C4)nc3)cc21 |
| InChI | InChI=1S/C36H46N4O6/c1-36(2,3)46-35(41)40-14-11-27(12-15-40)44-19-18-42-16-5-17-43-28-21-29(22-28)45-34-9-7-26(23-38-34)25-6-8-30-31-24-37-13-10-32(31)39(4)33(30)20-25/h6-10,13,20,23-24,27-29H,5,11-12,14-19,21-22H2,1-4H3 |
| InChIKey | MWVPXJNCIKNXHP-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 97.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.79 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|