C30H35N5O3 — CID 155583156
tert-butyl 3-[4-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]piperidin-1-yl]azetidine-1-carboxylate (PubChem CID 155583156) has the molecular formula C30H35N5O3 and a molecular weight of 513.64 g/mol. Its IUPAC name is tert-butyl 3-[4-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]piperidin-1-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]piperidin-1-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 155583156 |
| Molecular Formula | C30H35N5O3 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | tert-butyl 3-[4-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]piperidin-1-yl]azetidine-1-carboxylate |
| SMILES | Cn1c2ccncc2c2ccc(-c3ccc(OC4CCN(C5CN(C(=O)OC(C)(C)C)C5)CC4)nc3)cc21 |
| InChI | InChI=1S/C30H35N5O3/c1-30(2,3)38-29(36)35-18-22(19-35)34-13-10-23(11-14-34)37-28-8-6-21(16-32-28)20-5-7-24-25-17-31-12-9-26(25)33(4)27(24)15-20/h5-9,12,15-17,22-23H,10-11,13-14,18-19H2,1-4H3 |
| InChIKey | HSBZCSMFCTZMBE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|