C25H26N4O3 — CID 134489141
tert-butyl 3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]azetidine-1-carboxylate (PubChem CID 134489141) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is tert-butyl 3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 134489141 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | tert-butyl 3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]azetidine-1-carboxylate |
| SMILES | Cn1c2ccncc2c2ccc(-c3ccc(OC4CN(C(=O)OC(C)(C)C)C4)nc3)cc21 |
| InChI | InChI=1S/C25H26N4O3/c1-25(2,3)32-24(30)29-14-18(15-29)31-23-8-6-17(12-27-23)16-5-7-19-20-13-26-10-9-21(20)28(4)22(19)11-16/h5-13,18H,14-15H2,1-4H3 |
| InChIKey | FZVSCXOVMCZUCI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|