C26H23N5O2 — CID 134493002
5-methyl-7-[6-[3-(6-methylpyridazin-3-yl)oxycyclobutyl]oxy-3-pyridinyl]pyrido[4,3-b]indole (PubChem CID 134493002) has the molecular formula C26H23N5O2 and a molecular weight of 437.50 g/mol. Its IUPAC name is 5-methyl-7-[6-[3-(6-methylpyridazin-3-yl)oxycyclobutyl]oxy-3-pyridinyl]pyrido[4,3-b]indole.
| Compound Name | 5-methyl-7-[6-[3-(6-methylpyridazin-3-yl)oxycyclobutyl]oxy-3-pyridinyl]pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 134493002 |
| Molecular Formula | C26H23N5O2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 5-methyl-7-[6-[3-(6-methylpyridazin-3-yl)oxycyclobutyl]oxy-3-pyridinyl]pyrido[4,3-b]indole |
| SMILES | Cc1ccc(OC2CC(Oc3ccc(-c4ccc5c6cnccc6n(C)c5c4)cn3)C2)nn1 |
| InChI | InChI=1S/C26H23N5O2/c1-16-3-7-26(30-29-16)33-20-12-19(13-20)32-25-8-5-18(14-28-25)17-4-6-21-22-15-27-10-9-23(22)31(2)24(21)11-17/h3-11,14-15,19-20H,12-13H2,1-2H3 |
| InChIKey | CIVJKALOZVROEQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|