C30H34F2N4O4 — CID 134489277
7-[6-[3-[3-[3-(azetidin-3-yloxy)propoxy]propoxy]cyclobutyl]oxy-3-pyridinyl]-8,9-difluoro-5-methylpyrido[4,3-b]indole (PubChem CID 134489277) has the molecular formula C30H34F2N4O4 and a molecular weight of 552.62 g/mol. Its IUPAC name is 7-[6-[3-[3-[3-(azetidin-3-yloxy)propoxy]propoxy]cyclobutyl]oxy-3-pyridinyl]-8,9-difluoro-5-methylpyrido[4,3-b]indole.
| Compound Name | 7-[6-[3-[3-[3-(azetidin-3-yloxy)propoxy]propoxy]cyclobutyl]oxy-3-pyridinyl]-8,9-difluoro-5-methylpyrido[4,3-b]indole |
|---|---|
| PubChem CID | 134489277 |
| Molecular Formula | C30H34F2N4O4 |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | 7-[6-[3-[3-[3-(azetidin-3-yloxy)propoxy]propoxy]cyclobutyl]oxy-3-pyridinyl]-8,9-difluoro-5-methylpyrido[4,3-b]indole |
| SMILES | Cn1c2ccncc2c2c(F)c(F)c(-c3ccc(OC4CC(OCCCOCCCOC5CNC5)C4)nc3)cc21 |
| InChI | InChI=1S/C30H34F2N4O4/c1-36-25-6-7-33-18-24(25)28-26(36)14-23(29(31)30(28)32)19-4-5-27(35-15-19)40-21-12-20(13-21)38-10-2-8-37-9-3-11-39-22-16-34-17-22/h4-7,14-15,18,20-22,34H,2-3,8-13,16-17H2,1H3 |
| InChIKey | JYLGTGIBDOLDKM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 79.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|