C33H41F3N4O3 — CID 142365265
7-(6-cyclobutyloxy-3-pyridinyl)-5-methylpyrido[4,3-b]indole;3-[3,3,3-trifluoro-2-(5-methoxypentoxy)propyl]azetidine (PubChem CID 142365265) has the molecular formula C33H41F3N4O3 and a molecular weight of 598.71 g/mol. Its IUPAC name is 7-(6-cyclobutyloxy-3-pyridinyl)-5-methylpyrido[4,3-b]indole;3-[3,3,3-trifluoro-2-(5-methoxypentoxy)propyl]azetidine.
| Compound Name | 7-(6-cyclobutyloxy-3-pyridinyl)-5-methylpyrido[4,3-b]indole;3-[3,3,3-trifluoro-2-(5-methoxypentoxy)propyl]azetidine |
|---|---|
| PubChem CID | 142365265 |
| Molecular Formula | C33H41F3N4O3 |
| Molecular Weight | 598.71 g/mol |
| Exact Mass | 598.31 |
| IUPAC Name | 7-(6-cyclobutyloxy-3-pyridinyl)-5-methylpyrido[4,3-b]indole;3-[3,3,3-trifluoro-2-(5-methoxypentoxy)propyl]azetidine |
| SMILES | COCCCCCOC(CC1CNC1)C(F)(F)F.Cn1c2ccncc2c2ccc(-c3ccc(OC4CCC4)nc3)cc21 |
| InChI | InChI=1S/C21H19N3O.C12H22F3NO2/c1-24-19-9-10-22-13-18(19)17-7-5-14(11-20(17)24)15-6-8-21(23-12-15)25-16-3-2-4-16;1-17-5-3-2-4-6-18-11(12(13,14)15)7-10-8-16-9-10/h5-13,16H,2-4H2,1H3;10-11,16H,2-9H2,1H3 |
| InChIKey | ARXUJGMUBXEHRV-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 70.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.71 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|