C26H32F2N4O2 — CID 134199641
3-fluoro-N-[2-[[5-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-pyridinyl]oxy]ethyl]propan-1-amine (PubChem CID 134199641) has the molecular formula C26H32F2N4O2 and a molecular weight of 470.56 g/mol. Its IUPAC name is 3-fluoro-N-[2-[[5-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-pyridinyl]oxy]ethyl]propan-1-amine.
| Compound Name | 3-fluoro-N-[2-[[5-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-pyridinyl]oxy]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 134199641 |
| Molecular Formula | C26H32F2N4O2 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 3-fluoro-N-[2-[[5-[(1R,3R)-2-[(3-fluorooxetan-3-yl)methyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-2-pyridinyl]oxy]ethyl]propan-1-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(OCCNCCCF)nc2)N1CC1(F)COC1 |
| InChI | InChI=1S/C26H32F2N4O2/c1-18-13-21-20-5-2-3-6-22(20)31-24(21)25(32(18)15-26(28)16-33-17-26)19-7-8-23(30-14-19)34-12-11-29-10-4-9-27/h2-3,5-8,14,18,25,29,31H,4,9-13,15-17H2,1H3/t18-,25-/m1/s1 |
| InChIKey | JCZMXVSGVMATCH-IQGLISFBSA-N |
| XLogP | 3.97 |
| TPSA | 62.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|