C42H43N7O6 — CID 174206940
2-(2,6-dioxopiperidin-3-yl)-5-[2-[4-[methyl-[3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]amino]piperidin-1-yl]ethoxy]isoindole-1,3-dione (PubChem CID 174206940) has the molecular formula C42H43N7O6 and a molecular weight of 741.85 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[2-[4-[methyl-[3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]amino]piperidin-1-yl]ethoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[4-[methyl-[3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]amino]piperidin-1-yl]ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 174206940 |
| Molecular Formula | C42H43N7O6 |
| Molecular Weight | 741.85 g/mol |
| Exact Mass | 741.33 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[4-[methyl-[3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutyl]amino]piperidin-1-yl]ethoxy]isoindole-1,3-dione |
| SMILES | CN(C1CCN(CCOc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1)C1CC(Oc2ccc(-c3ccc4c5cnccc5n(C)c4c3)cn2)C1 |
| InChI | InChI=1S/C42H43N7O6/c1-46(28-20-30(21-28)55-39-10-4-26(23-44-39)25-3-6-31-34-24-43-14-11-35(34)47(2)37(31)19-25)27-12-15-48(16-13-27)17-18-54-29-5-7-32-33(22-29)42(53)49(41(32)52)36-8-9-38(50)45-40(36)51/h3-7,10-11,14,19,22-24,27-28,30,36H,8-9,12-13,15-18,20-21H2,1-2H3,(H,45,50,51) |
| InChIKey | MPTRSQLIMQBHOU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.85 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|