C41H42N6O9 — CID 134481772
2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[2-[2-[3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]azetidin-1-yl]ethoxy]ethoxy]ethoxy]ethoxy]isoindole-1,3-dione (PubChem CID 134481772) has the molecular formula C41H42N6O9 and a molecular weight of 762.82 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[2-[2-[3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]azetidin-1-yl]ethoxy]ethoxy]ethoxy]ethoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[2-[2-[3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]azetidin-1-yl]ethoxy]ethoxy]ethoxy]ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134481772 |
| Molecular Formula | C41H42N6O9 |
| Molecular Weight | 762.82 g/mol |
| Exact Mass | 762.30 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[2-[2-[3-[[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]azetidin-1-yl]ethoxy]ethoxy]ethoxy]ethoxy]isoindole-1,3-dione |
| SMILES | Cn1c2ccncc2c2ccc(-c3ccc(OC4CN(CCOCCOCCOCCOc5ccc6c(c5)C(=O)N(C5CCC(=O)NC5=O)C6=O)C4)nc3)cc21 |
| InChI | InChI=1S/C41H42N6O9/c1-45-34-10-11-42-23-33(34)30-5-2-26(20-36(30)45)27-3-9-38(43-22-27)56-29-24-46(25-29)12-13-52-14-15-53-16-17-54-18-19-55-28-4-6-31-32(21-28)41(51)47(40(31)50)35-7-8-37(48)44-39(35)49/h2-6,9-11,20-23,29,35H,7-8,12-19,24-25H2,1H3,(H,44,48,49) |
| InChIKey | HEMWKGQJDDAZEO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 163.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.82 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|