C41H40N6O10 — CID 134481291
2-[2-[2-[2-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-5-(5-methylpyrido[4,3-b]indol-7-yl)pyridine-3-carbonitrile (PubChem CID 134481291) has the molecular formula C41H40N6O10 and a molecular weight of 776.80 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-5-(5-methylpyrido[4,3-b]indol-7-yl)pyridine-3-carbonitrile.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-5-(5-methylpyrido[4,3-b]indol-7-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 134481291 |
| Molecular Formula | C41H40N6O10 |
| Molecular Weight | 776.80 g/mol |
| Exact Mass | 776.28 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-5-(5-methylpyrido[4,3-b]indol-7-yl)pyridine-3-carbonitrile |
| SMILES | Cn1c2ccncc2c2ccc(-c3cnc(OCCOCCOCCOCCOCCOc4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)c(C#N)c3)cc21 |
| InChI | InChI=1S/C41H40N6O10/c1-46-34-8-9-43-25-33(34)30-4-2-26(21-36(30)46)28-20-27(23-42)39(44-24-28)57-19-17-55-15-13-53-11-10-52-12-14-54-16-18-56-29-3-5-31-32(22-29)41(51)47(40(31)50)35-6-7-37(48)45-38(35)49/h2-5,8-9,20-22,24-25,35H,6-7,10-19H2,1H3,(H,45,48,49) |
| InChIKey | LERKWXPPCKITTN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 193.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.80 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|