C42H45N5O8 — CID 167556827
2-(6-methylidene-2-oxopiperidin-3-yl)-5-[2-[2-[2-[2-[3-[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]isoindole-1,3-dione (PubChem CID 167556827) has the molecular formula C42H45N5O8 and a molecular weight of 747.85 g/mol. Its IUPAC name is 2-(6-methylidene-2-oxopiperidin-3-yl)-5-[2-[2-[2-[2-[3-[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]isoindole-1,3-dione.
| Compound Name | 2-(6-methylidene-2-oxopiperidin-3-yl)-5-[2-[2-[2-[2-[3-[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167556827 |
| Molecular Formula | C42H45N5O8 |
| Molecular Weight | 747.85 g/mol |
| Exact Mass | 747.33 |
| IUPAC Name | 2-(6-methylidene-2-oxopiperidin-3-yl)-5-[2-[2-[2-[2-[3-[5-(5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]propoxy]ethoxy]ethoxy]ethoxy]ethoxy]isoindole-1,3-dione |
| SMILES | C=C1CCC(N2C(=O)c3ccc(OCCOCCOCCOCCOCCCc4ccc(-c5ccc6c7cnccc7n(C)c6c5)cn4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C42H45N5O8/c1-28-5-12-38(40(48)45-28)47-41(49)34-11-9-32(25-35(34)42(47)50)55-23-22-54-21-20-53-19-18-52-17-16-51-15-3-4-31-8-6-30(26-44-31)29-7-10-33-36-27-43-14-13-37(36)46(2)39(33)24-29/h6-11,13-14,24-27,38H,1,3-5,12,15-23H2,2H3,(H,45,48) |
| InChIKey | ZKZIJYBVFSBURB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 143.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.85 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|