C43H47N7O6 — CID 134481722
2-(2,6-dioxopiperidin-3-yl)-5-[5-[4-[2-[3-[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]propoxy]ethyl]piperazin-1-yl]pentoxy]isoindole-1,3-dione (PubChem CID 134481722) has the molecular formula C43H47N7O6 and a molecular weight of 757.89 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[5-[4-[2-[3-[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]propoxy]ethyl]piperazin-1-yl]pentoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[5-[4-[2-[3-[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]propoxy]ethyl]piperazin-1-yl]pentoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134481722 |
| Molecular Formula | C43H47N7O6 |
| Molecular Weight | 757.89 g/mol |
| Exact Mass | 757.36 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[5-[4-[2-[3-[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]propoxy]ethyl]piperazin-1-yl]pentoxy]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(OCCCCCN4CCN(CCOCCCc5ccc(-c6ccc7c(c6)[nH]c6ccncc67)cn5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C43H47N7O6/c51-40-13-12-39(41(52)47-40)50-42(53)34-11-9-32(26-35(34)43(50)54)56-23-3-1-2-16-48-17-19-49(20-18-48)21-24-55-22-4-5-31-8-6-30(27-45-31)29-7-10-33-36-28-44-15-14-37(36)46-38(33)25-29/h6-11,14-15,25-28,39,46H,1-5,12-13,16-24H2,(H,47,51,52) |
| InChIKey | HZIUFNXFMUCJFP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 150.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.89 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|